2,5-Dioxopyrrolidin-1-yl nicotinate
Modify Date: 2024-02-08 09:40:03
2,5-Dioxopyrrolidin-1-yl nicotinate structure
|
Common Name | 2,5-Dioxopyrrolidin-1-yl nicotinate | ||
|---|---|---|---|---|
| CAS Number | 78348-28-4 | Molecular Weight | 220.18200 | |
| Density | 1.46g/cm3 | Boiling Point | 370.3ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O4 | Melting Point | 127-130ºC | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | (2,5-dioxopyrrolidin-1-yl) pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760 mmHg |
| Melting Point | 127-130ºC |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18200 |
| Flash Point | 177.7ºC |
| Exact Mass | 220.04800 |
| PSA | 76.57000 |
| LogP | 0.24030 |
| Index of Refraction | 1.602 |
| InChIKey | CWBHSNGMXKJGSM-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cccnc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
|
~99%
2,5-Dioxopyrrol... CAS#:78348-28-4 |
| Literature: Ohno, Atsuyoshi; Ushida, Satoshi; Oka, Shinzaburo Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 2 p. 564 - 567 |
|
~62%
2,5-Dioxopyrrol... CAS#:78348-28-4 |
| Literature: Lou, Rongliang; VanAlstine, Melissa; Sun, Xufeng; Wentland, Mark P. Tetrahedron Letters, 2003 , vol. 44, # 12 p. 2477 - 2480 |
CAS#:29876-14-0![3-Pyridinecarboxamide,N-[2-hydroxy-1,1-bis(hydroxymethyl)ethyl]- structure](https://image.chemsrc.com/caspic/372/6323-83-7.png)
CAS#:6323-83-7| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| nicotinic acid N-hydroxysuccinimide ester |
| 1-(pyridine-3-carbonyloxy)-pyrrolidine-2,5-dione |
| Succinimidyl Nicotinate |
| N-(3-Pyridinyloyloxy)succinimide |
| N-hydroxysuccinimide of nicotinic acid |
| nicotinic acid N-hydroxysuccinimidyl ester |
| N-<(3-pyridylcarbonyl)oxy>succinimide |
| N-hydroxysuccinimide ester of nicotinic acid |
| N-(Nicotinoyloxy)succinimide |