1-(6-Aminohexyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedion e
Modify Date: 2025-09-20 02:54:39
1-(6-Aminohexyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedion e structure
|
Common Name | 1-(6-Aminohexyl)-4-((4-(diethylamino)phenyl)methyl)-2,3-piperazinedion e | ||
|---|---|---|---|---|
| CAS Number | 78201-94-2 | Molecular Weight | 374.52000 | |
| Density | 1.107g/cm3 | Boiling Point | 531.3ºC at 760 mmHg | |
| Molecular Formula | C21H34N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1ºC | |
| Name | 1-(6-aminohexyl)-4-[[4-(diethylamino)phenyl]methyl]piperazine-2,3-dione |
|---|
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 531.3ºC at 760 mmHg |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.52000 |
| Flash Point | 275.1ºC |
| Exact Mass | 374.26800 |
| PSA | 69.88000 |
| LogP | 2.79880 |
| Index of Refraction | 1.563 |
| InChIKey | IRNKVRIGNMQQFI-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(CN2CCN(CCCCCCN)C(=O)C2=O)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |