4-Nitrobenzoylglycylglycine structure
|
Common Name | 4-Nitrobenzoylglycylglycine | ||
|---|---|---|---|---|
| CAS Number | 78196-53-9 | Molecular Weight | 281.22200 | |
| Density | 1.466g/cm3 | Boiling Point | 694.1ºC at 760 mmHg | |
| Molecular Formula | C11H11N3O6 | Melting Point | 218ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Nitrobenzoylglycylglycine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 694.1ºC at 760 mmHg |
| Melting Point | 218ºC |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22200 |
| Exact Mass | 281.06500 |
| PSA | 141.32000 |
| LogP | 0.83040 |
| Index of Refraction | 1.599 |
| InChIKey | WQJHGFSTRONKLC-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~%
4-Nitrobenzoylg... CAS#:78196-53-9 |
| Literature: Journal of Experimental Medicine, , vol. 55, p. 781,785 |
|
~%
4-Nitrobenzoylg... CAS#:78196-53-9 |
| Literature: Canadian Journal of Chemistry, , vol. 76, # 6 p. 729 - 737 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetic acid |