4-(4-bromophenyl)-2-methyl-5-nitrooxazole structure
|
Common Name | 4-(4-bromophenyl)-2-methyl-5-nitrooxazole | ||
|---|---|---|---|---|
| CAS Number | 78164-40-6 | Molecular Weight | 283.07800 | |
| Density | 1.617g/cm3 | Boiling Point | 381.9ºC at 760 mmHg | |
| Molecular Formula | C10H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.8ºC | |
| Name | 4-(4-bromophenyl)-2-methyl-5-nitro-1,3-oxazole |
|---|
| Density | 1.617g/cm3 |
|---|---|
| Boiling Point | 381.9ºC at 760 mmHg |
| Molecular Formula | C10H7BrN2O3 |
| Molecular Weight | 283.07800 |
| Flash Point | 184.8ºC |
| Exact Mass | 281.96400 |
| PSA | 71.85000 |
| LogP | 3.84390 |
| Index of Refraction | 1.605 |
| InChIKey | FZEZSAYAMCCVHV-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(Br)cc2)c([N+](=O)[O-])o1 |
| HS Code | 2934999090 |
|---|
|
~%
4-(4-bromopheny... CAS#:78164-40-6 |
| Literature: Hammar; Rustad Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 5 p. 885 - 888 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |