Carbonic acid, 4-(chlorocarbonyl)phenyl methyl ester (9CI)
Modify Date: 2025-09-30 01:59:43
Carbonic acid, 4-(chlorocarbonyl)phenyl methyl ester (9CI) structure
|
Common Name | Carbonic acid, 4-(chlorocarbonyl)phenyl methyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 78152-12-2 | Molecular Weight | 214.60200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-carbonochloridoylphenyl) methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7ClO4 |
|---|---|
| Molecular Weight | 214.60200 |
| Exact Mass | 214.00300 |
| PSA | 52.60000 |
| LogP | 2.21080 |
| InChIKey | LNOGRKDHGJQANU-UHFFFAOYSA-N |
| SMILES | COC(=O)Oc1ccc(C(=O)Cl)cc1 |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Methoxycarbonyloxy-benzoylchlorid |
| 4-Carbomethoxy-oxybenzoylchlorid |