1-(4-CHLOROPHENYL)-2,2,3,3,3-PENTAFLUORO-PROPAN-1-ONE structure
|
Common Name | 1-(4-CHLOROPHENYL)-2,2,3,3,3-PENTAFLUORO-PROPAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 781-97-5 | Molecular Weight | 258.57200 | |
| Density | 1.462g/cm3 | Boiling Point | 186ºC | |
| Molecular Formula | C9H4ClF5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.7ºC | |
| Name | 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 186ºC |
| Molecular Formula | C9H4ClF5O |
| Molecular Weight | 258.57200 |
| Flash Point | 88.7ºC |
| Exact Mass | 257.98700 |
| PSA | 17.07000 |
| LogP | 3.72030 |
| Index of Refraction | 1.439 |
| InChIKey | SVCOUMOZVHFUSG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
|
~%
1-(4-CHLOROPHEN... CAS#:781-97-5 |
| Literature: Kaluszyner; Cohen Journal of Organic Chemistry, 1959 , vol. 24, p. 996 |
|
~29%
1-(4-CHLOROPHEN... CAS#:781-97-5 |
| Literature: Burton, Donald J.; Headley, James A. Journal of Fluorine Chemistry, 1981 , vol. 18, p. 323 - 356 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Chlor-phenyl)-2,2,3,3,3-pentafluor-propan-1-on |
| pentafuoroethyl p-chlorophenyl ketone |
| 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropane-1-one |
| 1-(4-Chlorophenyl)-2,2,3,3,3-pentafluoro |
| 1-(4-chloro-phenyl)-2,2,3,3,3-pentafluoro-propan-1-one |