2,3-Dihydro-2-oxo-3,3-diphenyl-1H-indole-7-carboxamide
Modify Date: 2025-11-26 11:32:00
2,3-Dihydro-2-oxo-3,3-diphenyl-1H-indole-7-carboxamide structure
|
Common Name | 2,3-Dihydro-2-oxo-3,3-diphenyl-1H-indole-7-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 78033-98-4 | Molecular Weight | 328.36400 | |
| Density | 1.279g/cm3 | Boiling Point | 521.4ºC at 760 mmHg | |
| Molecular Formula | C21H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.1ºC | |
| Name | 2-oxo-3,3-diphenyl-1H-indole-7-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 521.4ºC at 760 mmHg |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.36400 |
| Flash Point | 269.1ºC |
| Exact Mass | 328.12100 |
| PSA | 76.67000 |
| LogP | 4.04130 |
| Index of Refraction | 1.662 |
| InChIKey | KYEFTLVKORUXBZ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cccc2c1NC(=O)C2(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 7-Indolinecarboxamide,3,3-diphenyl-2-oxo |
| 1H-INDOLE-7-CARBOXAMIDE,2,3-DIHYDRO-2-OXO-3,3-DIPHENYL |
| 3,3-Diphenyl-2-oxo-7-indolinecarboxamide |
| Amide of 3,3-diphenyl-2-oxoindoline-7-carboxylic acid |