ethyl (5-amino-3-methyl-triazol-4-yl)methylcarbamoylformate structure
|
Common Name | ethyl (5-amino-3-methyl-triazol-4-yl)methylcarbamoylformate | ||
|---|---|---|---|---|
| CAS Number | 77976-45-5 | Molecular Weight | 227.22100 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(5-amino-3-methyltriazol-4-yl)methylamino]-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22100 |
| Exact Mass | 227.10200 |
| PSA | 112.13000 |
| Index of Refraction | 1.627 |
| InChIKey | MGKGJBBTPSYTMM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NCc1c(N)nnn1C |
|
~93%
ethyl (5-amino-... CAS#:77976-45-5 |
| Literature: Albert, Adrien Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 887 - 891 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-amino-5-ethoxalylaminomethyl-1-methyl-1H-1,2,3-triazole |
| Acetic acid,2,3-triazol-5-yl)methyl]amino]oxo-,ethyl ester |