(4-ethynyl-2-methylideneheptyl)-trimethylsilane structure
|
Common Name | (4-ethynyl-2-methylideneheptyl)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 779349-09-6 | Molecular Weight | 208.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-ethynyl-2-methylideneheptyl)-trimethylsilane |
|---|
| Molecular Formula | C13H24Si |
|---|---|
| Molecular Weight | 208.41500 |
| Exact Mass | 208.16500 |
| LogP | 4.32040 |
| InChIKey | HODQURLZAKIKNY-UHFFFAOYSA-N |
| SMILES | C#CC(CCC)CC(=C)C[Si](C)(C)C |
|
~%
(4-ethynyl-2-me... CAS#:779349-09-6 |
| Literature: Sun, Jianwei; Conley, Matthew P.; Zhang, Liming; Kozmin, Sergey A. Journal of the American Chemical Society, 2006 , vol. 128, # 30 p. 9705 - 9710 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |