(2-oxo-2-p-tolyl-ethyl)-carbamic acid tert-butyl ester
Modify Date: 2025-09-22 18:28:05
(2-oxo-2-p-tolyl-ethyl)-carbamic acid tert-butyl ester structure
|
Common Name | (2-oxo-2-p-tolyl-ethyl)-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 778617-65-5 | Molecular Weight | 249.30600 | |
| Density | 1.074g/cm3 | Boiling Point | 392.1ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | (2-oxo-2-p-tolyl-ethyl)-carbamic acid tert-butyl ester |
|---|
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 392.1ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 191ºC |
| Exact Mass | 249.13600 |
| PSA | 55.40000 |
| LogP | 3.09330 |
| Index of Refraction | 1.511 |
| InChIKey | IIDSANGRQVUKNI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CNC(=O)OC(C)(C)C)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |