2-(hydroxymethyl)-5-methoxy-1-phenylpyridin-4-one structure
|
Common Name | 2-(hydroxymethyl)-5-methoxy-1-phenylpyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 77816-61-6 | Molecular Weight | 231.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(hydroxymethyl)-5-methoxy-1-phenylpyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO3 |
|---|---|
| Molecular Weight | 231.24700 |
| Exact Mass | 231.09000 |
| PSA | 51.46000 |
| LogP | 1.33840 |
| InChIKey | ACHLZZQNPBIDPA-UHFFFAOYSA-N |
| SMILES | COc1cn(-c2ccccc2)c(CO)cc1=O |
|
~69%
2-(hydroxymethy... CAS#:77816-61-6 |
| Literature: Looker, James H.; Cliffton, Michael D. Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 5 - 8 |
|
~33%
2-(hydroxymethy... CAS#:77816-61-6 |
| Literature: Looker, James H.; Cliffton, Michael D. Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 5 - 8 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-methoxy-2-methylol-1-phenyl-4-pyridone |