Cyclopropanecarbonyl chloride, 3-(cyclopentylidenemethyl)-2,2-dimethyl-, (1R-cis)- (9CI)
Modify Date: 2025-08-20 18:17:54
Cyclopropanecarbonyl chloride, 3-(cyclopentylidenemethyl)-2,2-dimethyl-, (1R-cis)- (9CI) structure
|
Common Name | Cyclopropanecarbonyl chloride, 3-(cyclopentylidenemethyl)-2,2-dimethyl-, (1R-cis)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 77789-43-6 | Molecular Weight | 212.71600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1R,3S)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|
| Molecular Formula | C12H17ClO |
|---|---|
| Molecular Weight | 212.71600 |
| Exact Mass | 212.09700 |
| PSA | 17.07000 |
| LogP | 3.52440 |
| InChIKey | MQAGSSWNUYYWCU-UWVGGRQHSA-N |
| SMILES | CC1(C)C(C=C2CCCC2)C1C(=O)Cl |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |