Cyclopentylalbendazole structure
|
Common Name | Cyclopentylalbendazole | ||
|---|---|---|---|---|
| CAS Number | 77723-30-9 | Molecular Weight | 291.369 | |
| Density | 1.3±0.0 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | Cyclopentylalbendazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.0 g/cm3 |
|---|---|
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.369 |
| Exact Mass | 291.104156 |
| LogP | 3.33 |
| Index of Refraction | 1.655 |
| InChIKey | OMWVEUDQOPUZNX-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1nc2ccc(SC3CCCC3)cc2[nH]1 |
| RIDADR | NONH for all modes of transport |
|---|
| Methyl [5-(cyclopentylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
| Methyl [5-(cyclopentylthio)-1H-benzimidazol-2-yl]carbamate |
| MFCD26142900 |
| Carbamic acid, N-[5-(cyclopentylthio)-1H-benzimidazol-2-yl]-, methyl ester |
| (5-Cyclopentanesulfanyl-1H-benzoimidazol-2-yl)carbamic acid methyl ester |
| Cyclopentylalbendazole |