N-methyl-4,5-dioxo-N-(4-phenylsulfanylphenyl)-1-propan-2-yl-pyrrolidin e-3-carboxamide
Modify Date: 2025-09-22 20:30:03
N-methyl-4,5-dioxo-N-(4-phenylsulfanylphenyl)-1-propan-2-yl-pyrrolidin e-3-carboxamide structure
|
Common Name | N-methyl-4,5-dioxo-N-(4-phenylsulfanylphenyl)-1-propan-2-yl-pyrrolidin e-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 77711-85-4 | Molecular Weight | 382.47600 | |
| Density | 1.28g/cm3 | Boiling Point | 564ºC at 760 mmHg | |
| Molecular Formula | C21H22N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.9ºC | |
| Name | N-methyl-4,5-dioxo-N-(4-phenylsulfanylphenyl)-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 564ºC at 760 mmHg |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.47600 |
| Flash Point | 294.9ºC |
| Exact Mass | 382.13500 |
| PSA | 82.99000 |
| LogP | 3.17440 |
| Index of Refraction | 1.642 |
| InChIKey | VVPPQVNHQGUJOH-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC(C(=O)N(C)c2ccc(Sc3ccccc3)cc2)C(=O)C1=O |
| HS Code | 2933990090 |
|---|
|
~49%
N-methyl-4,5-di... CAS#:77711-85-4 |
| Literature: Marcincal-Lefebvre; Gesquiere; Lemer; Dupuis Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 889 - 893 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |