4-methyl-5-(4-morpholin-4-ylbenzoyl)-1,3-dihydroimidazol-2-one structure
|
Common Name | 4-methyl-5-(4-morpholin-4-ylbenzoyl)-1,3-dihydroimidazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 77671-27-3 | Molecular Weight | 287.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-5-(4-morpholin-4-ylbenzoyl)-1,3-dihydroimidazol-2-one |
|---|
| Molecular Formula | C15H17N3O3 |
|---|---|
| Molecular Weight | 287.31400 |
| Exact Mass | 287.12700 |
| PSA | 78.45000 |
| LogP | 1.55630 |
| InChIKey | ALZQNZWRPCERET-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)[nH]c1C(=O)c1ccc(N2CCOCC2)cc1 |
|
~%
4-methyl-5-(4-m... CAS#:77671-27-3 |
| Literature: Schnettler; Dage; Grisar Journal of Medicinal Chemistry, 1982 , vol. 25, # 12 p. 1477 - 1481 |
|
~61%
4-methyl-5-(4-m... CAS#:77671-27-3 |
| Literature: Schnettler; Dage; Grisar Journal of Medicinal Chemistry, 1982 , vol. 25, # 12 p. 1477 - 1481 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |