N,N'-(2,3-DINITRO-1,4-PHENYLENE) BISACETAMIDE structure
|
Common Name | N,N'-(2,3-DINITRO-1,4-PHENYLENE) BISACETAMIDE | ||
|---|---|---|---|---|
| CAS Number | 7756-00-5 | Molecular Weight | 282.21000 | |
| Density | 1.574 g/cm3 | Boiling Point | 585ºC at 760 mmHg | |
| Molecular Formula | C10H10N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.6ºC | |
| Name | N-(4-acetamido-2,3-dinitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.574 g/cm3 |
|---|---|
| Boiling Point | 585ºC at 760 mmHg |
| Molecular Formula | C10H10N4O6 |
| Molecular Weight | 282.21000 |
| Flash Point | 307.6ºC |
| Exact Mass | 282.06000 |
| PSA | 149.84000 |
| LogP | 2.61220 |
| Index of Refraction | 1.681 |
| InChIKey | DGNNIDWBARYYSR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NC(C)=O)c([N+](=O)[O-])c1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-diacetyl-2,3-dinitro-1,4-phenylenediamine |
| N,N'-Diacetyl-2,3-dinitro-phenylen-1,4-diamin |
| 1,4-Diacetamido-2,3-dinitrobenzene |