Testosterone-d3
Testosterone-d3 structure
|
Common Name | Testosterone-d3 | ||
|---|---|---|---|---|
| CAS Number | 77546-39-5 | Molecular Weight | 291.44300 | |
| Density | 1.134 g/cm3 | Boiling Point | 432.925ºC at 760 mmHg | |
| Molecular Formula | C19H25D3O2 | Melting Point | 148-150ºC | |
| MSDS | Chinese USA | Flash Point | 5ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | Testosterone-d3 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134 g/cm3 |
|---|---|
| Boiling Point | 432.925ºC at 760 mmHg |
| Melting Point | 148-150ºC |
| Molecular Formula | C19H25D3O2 |
| Molecular Weight | 291.44300 |
| Flash Point | 5ºC |
| Exact Mass | 291.22800 |
| PSA | 37.30000 |
| LogP | 3.87920 |
| InChIKey | MUMGGOZAMZWBJJ-HZRGXLBSSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(O)CCC12 |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Supplemental HS | May form explosive peroxides. |
| Precautionary Statements | P210-P261-P302 + P352 + P312-P304 + P340 + P312-P337 + P313-P403 + P235 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | F,T |
| Risk Phrases | R61 |
| Safety Phrases | 53-45-36/37/39-22 |
| RIDADR | UN 2252 3/PG 2 |
| WGK Germany | 3 |
|
~92%
Testosterone-d3 CAS#:77546-39-5 |
| Literature: Jarman, Michael; McCague, Raymond Journal of the Chemical Society, Chemical Communications, 1986 , # 8 p. 635 - 636 |
|
~%
Testosterone-d3 CAS#:77546-39-5 |
| Literature: Jarman, Michael; McCague, Raymond Journal of the Chemical Society, Chemical Communications, 1986 , # 8 p. 635 - 636 |
|
~%
Testosterone-d3 CAS#:77546-39-5 |
| Literature: Jarman, Michael; McCague, Raymond Journal of the Chemical Society, Chemical Communications, 1986 , # 8 p. 635 - 636 |
![3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy][16,16,17α-(2)H3]androsta-3,4-diene-17β-ol structure](https://image.chemsrc.com/caspic/090/103708-02-7.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
High throughput quantification of prohibited substances in plasma using thin film solid phase microextraction.
J. Chromatogr. A. 1374 , 40-9, (2014) Simple, fast and efficient sample preparation approaches that allow high-throughput isolation of various compounds from complex matrices are highly desired in bioanalysis. Particularly sought are meth... |
|
|
Pomegranate extracts impact the androgen biosynthesis pathways in prostate cancer models in vitro and in vivo.
J. Steroid Biochem. Mol. Biol. 143 , 19-28, (2014) Castration-resistant prostate cancer (CRPC) remains largely dependent on androgen receptor (AR). Residual tissue androgens are consistently detected within CRPC tumors and play a critical role in faci... |
|
|
Assessment of testicular corticosterone biosynthesis in adult male rats.
PLoS ONE 10(2) , e0117795, (2015) Corticosterone is synthesized in the adrenal glands and is circulated throughout the body to perform regulatory functions in various tissues. The testis is known to synthesize and secrete testosterone... |
| (8R,9S,10R,13S,14S,17S)-16,16,17-trideuterio-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |