7-methoxybenzo[e][1]benzofuran-2-carboxylic acid
Modify Date: 2025-09-18 10:54:31
![7-methoxybenzo[e][1]benzofuran-2-carboxylic acid Structure](https://image.chemsrc.com/caspic/022/77523-53-6.png)
7-methoxybenzo[e][1]benzofuran-2-carboxylic acid structure
|
Common Name | 7-methoxybenzo[e][1]benzofuran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 77523-53-6 | Molecular Weight | 242.22700 | |
| Density | 1.368g/cm3 | Boiling Point | 452.9ºC at 760 mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 7-methoxybenzo[e][1]benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 452.9ºC at 760 mmHg |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.22700 |
| Flash Point | 227.7ºC |
| Exact Mass | 242.05800 |
| PSA | 59.67000 |
| LogP | 3.29280 |
| Index of Refraction | 1.692 |
| InChIKey | YBQPPMVQNODYGJ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(ccc3oc(C(=O)O)cc32)c1 |
|
~%
7-methoxybenzo[... CAS#:77523-53-6 |
| Literature: Cavier; Buisson; Lemoine; Royer European Journal of Medicinal Chemistry, 1981 , vol. 16, # 1 p. 73 - 76 |
|
~%
7-methoxybenzo[... CAS#:77523-53-6 |
| Literature: Cavier; Buisson; Lemoine; Royer European Journal of Medicinal Chemistry, 1981 , vol. 16, # 1 p. 73 - 76 |
![ethyl 7-methoxybenzo[e][1]benzofuran-2-carboxylate structure](https://image.chemsrc.com/caspic/484/77523-54-7.png)
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:77523-52-5| r 7186 |