1,3-bis(4-(4-ethyl-2,3-dioxo-1-piperazinyl)butyl)urea
Modify Date: 2025-08-25 17:11:05
1,3-bis(4-(4-ethyl-2,3-dioxo-1-piperazinyl)butyl)urea structure
|
Common Name | 1,3-bis(4-(4-ethyl-2,3-dioxo-1-piperazinyl)butyl)urea | ||
|---|---|---|---|---|
| CAS Number | 77439-72-6 | Molecular Weight | 452.54800 | |
| Density | 1.184g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H36N6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis[4-(4-ethyl-2,3-dioxopiperazin-1-yl)butyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Molecular Formula | C21H36N6O5 |
| Molecular Weight | 452.54800 |
| Exact Mass | 452.27500 |
| PSA | 125.86000 |
| Index of Refraction | 1.526 |
| InChIKey | TULFHXPGSKNDDQ-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CCCCNC(=O)NCCCCN2CCN(CC)C(=O)C2=O)C(=O)C1=O |
| HS Code | 2933599090 |
|---|
|
~%
1,3-bis(4-(4-et... CAS#:77439-72-6 |
| Literature: Hori; Yoshida; Murakami; Kiba; Takeno; Nakano; Tsuda; Saikawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 2 p. 386 - 389 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Bedp-BU |