BO-0742 structure
|
Common Name | BO-0742 | ||
|---|---|---|---|---|
| CAS Number | 774234-08-1 | Molecular Weight | 484.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BO-0742BO-0742, a derivative of AHMA and N-mustard, is a potent anti-cancer agent. BO-0742 significantly suppresses the growth of xenografts of human breast and ovarian cancers in mice[1]. |
| Name | [3-(acridin-9-ylamino)-5-[2-[bis(2-chloroethyl)amino]ethoxy]phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Description | BO-0742, a derivative of AHMA and N-mustard, is a potent anti-cancer agent. BO-0742 significantly suppresses the growth of xenografts of human breast and ovarian cancers in mice[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H27Cl2N3O2 |
|---|---|
| Molecular Weight | 484.41700 |
| Exact Mass | 483.14800 |
| PSA | 60.85000 |
| LogP | 5.20420 |
| InChIKey | SRZKWNZALGFBCW-UHFFFAOYSA-N |
| SMILES | OCc1cc(Nc2c3ccccc3nc3ccccc23)cc(OCCN(CCCl)CCCl)c1 |
| unii-yq6ny3jb0c |
| bo-0742 |