4-(Trifluoromethyl)phenylalanine
Modify Date: 2025-08-22 22:40:32
4-(Trifluoromethyl)phenylalanine structure
|
Common Name | 4-(Trifluoromethyl)phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 774178-39-1 | Molecular Weight | 233.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 315.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8±27.9 °C | |
| Name | (R)-3-(p-Trifluoromethylphenyl)-beta-alanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.9±42.0 °C at 760 mmHg |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.187 |
| Flash Point | 144.8±27.9 °C |
| Exact Mass | 233.066360 |
| PSA | 63.32000 |
| LogP | 1.52 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | ABDRZHVLIRZFQO-MRVPVSSYSA-N |
| SMILES | NC(CC(=O)O)c1ccc(C(F)(F)F)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzeneacetic acid, α-(aminomethyl)-4-(trifluoromethyl)-, (αR)- |
| (2S)-2-Amino-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| (2R)-3-Amino-2-[4-(trifluoromethyl)phenyl]propanoic acid |
| 4-Trifluromethyl-L-phenylalanine |
| (3R)-3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| 4-(Trifluoromethyl)phenylalanine |
| Phenylalanine, 4-(trifluoromethyl)- |
| 4-(Trifluoromethyl)-L-phenylalanine |