Didemnin B (9CI)
Modify Date: 2025-08-25 15:16:46
Didemnin B (9CI) structure
|
Common Name | Didemnin B (9CI) | ||
|---|---|---|---|---|
| CAS Number | 77327-05-0 | Molecular Weight | 1112.35000 | |
| Density | 1.24g/cm3 | Boiling Point | 1274.4ºC at 760 mmHg | |
| Molecular Formula | C57H89N7O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 724.5ºC | |
Use of Didemnin B (9CI)Didemnin B is a depsipeptide extracted from the marine tunicate Trididemnin cyanophorum. Didemnin B can be used for the research of cancer[1]. |
| Name | Didemnin B |
|---|
| Description | Didemnin B is a depsipeptide extracted from the marine tunicate Trididemnin cyanophorum. Didemnin B can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Didemnin B has activity against miirine B16 melanoma, P388 leukemia, and M5076 sarcoma[1]. |
| In Vivo | Didemnin B is a potent inhibitor of L1210 growth[1]. |
| References |
[1]. Stewart JA, et al. A phase I clinical trial of didemnin B. Cancer. 1991;68(12):2550-2554. |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 1274.4ºC at 760 mmHg |
| Molecular Formula | C57H89N7O15 |
| Molecular Weight | 1112.35000 |
| Flash Point | 724.5ºC |
| Exact Mass | 1111.64000 |
| PSA | 287.90000 |
| LogP | 3.17870 |
| Index of Refraction | 1.569 |
| InChIKey | KYHUYMLIVQFXRI-SJPGYWQQSA-N |
| SMILES | CCC(C)C1NC(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)C2CCCN2C(=O)C(C)O)C(C)OC(=O)C(Cc2ccc(OC)cc2)N(C)C(=O)C2CCCN2C(=O)C(CC(C)C)NC(=O)C(C)C(=O)C(C(C)C)OC(=O)CC1O |
| Storage condition | -20°C |