2-(Aminocarbonyl)-3-nitrobenzoic acid structure
|
Common Name | 2-(Aminocarbonyl)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 77326-45-5 | Molecular Weight | 210.14400 | |
| Density | 1.585 g/cm3 | Boiling Point | 398.5ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-carbamoyl-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585 g/cm3 |
|---|---|
| Boiling Point | 398.5ºC at 760 mmHg |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.14400 |
| Exact Mass | 210.02800 |
| PSA | 126.21000 |
| LogP | 1.61540 |
| Index of Refraction | 1.655 |
| InChIKey | IGLWGHRTQOYFDV-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(C(=O)O)cccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~90%
2-(Aminocarbony... CAS#:77326-45-5 |
| Literature: Muller, George; Man, Hon-Wah; Cohen, Benjamin M.; Li, Ying; Xu, Jean; Leong, William W. Patent: US2012/232100 A1, 2012 ; Location in patent: Page/Page column 24 ; |
|
~68%
2-(Aminocarbony... CAS#:77326-45-5 |
| Literature: GRUeNENTHAL GMBH; SCHUNK, Stefan; REICH, Melanie; ENGELS, Michael; GERMANN, Tieno; DE VRY, Jean; JOSTOCK, Ruth; HEES, Sabine Patent: WO2010/142402 A1, 2010 ; Location in patent: Page/Page column 109 ; |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Nitro-phthalamidsaeure |
| 2-Carboxy-6-nitrobenzamide |
| 2-Aminocarbonyl-3-nitrobenzoic acid |
| 6-nitro-2-carboxybenzamide |
| 3-Nitro-phthalamic acid |
| BEN128 |