5-(2-naphthalen-2-yloxyethyl)-1H-imidazole structure
|
Common Name | 5-(2-naphthalen-2-yloxyethyl)-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 7728-79-2 | Molecular Weight | 238.28400 | |
| Density | 1.213g/cm3 | Boiling Point | 511.9ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | 5-(2-naphthalen-2-yloxyethyl)-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 511.9ºC at 760 mmHg |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.28400 |
| Flash Point | 181.2ºC |
| Exact Mass | 238.11100 |
| PSA | 37.91000 |
| LogP | 3.18440 |
| Index of Refraction | 1.659 |
| InChIKey | PGMKRSXAILDXTQ-UHFFFAOYSA-N |
| SMILES | c1ccc2cc(OCCc3cnc[nH]3)ccc2c1 |
|
~%
5-(2-naphthalen... CAS#:7728-79-2 |
| Literature: Ganellin, C. Robin; Fkyerat, Abdellatif; Bang-Andersen, Benny; Athmani, Salah; Tertiuk, Wasyl; Garbarg, Monique; Ligneau, Xavier; Schwartz, Jean-Charles Journal of Medicinal Chemistry, 1996 , vol. 39, # 19 p. 3806 - 3813 |
|
~%
5-(2-naphthalen... CAS#:7728-79-2 |
| Literature: Huebner et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 3942 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| su-435 |