1-(4-ethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one
Modify Date: 2025-09-11 16:52:30
1-(4-ethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one structure
|
Common Name | 1-(4-ethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 77264-49-4 | Molecular Weight | 297.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-ethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one |
|---|
| Molecular Formula | C17H15NO4 |
|---|---|
| Molecular Weight | 297.30500 |
| Exact Mass | 297.10000 |
| PSA | 72.12000 |
| LogP | 4.41280 |
| InChIKey | RQKNFITTYZAZCF-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)C=Cc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-(4-ethoxyphen... CAS#:77264-49-4 |
| Literature: Has, Chandra; Saharia; Sharma Journal of the Indian Chemical Society, 1996 , vol. 73, # 11 p. 614 - 615 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |