5-Methyl-6H-pyrido(4,3-b)carbazol-9-ol structure
|
Common Name | 5-Methyl-6H-pyrido(4,3-b)carbazol-9-ol | ||
|---|---|---|---|---|
| CAS Number | 77253-64-6 | Molecular Weight | 248.27900 | |
| Density | 1.394g/cm3 | Boiling Point | 562.8ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | 5-Methyl-6H-pyrido[4,3-b]carbazol-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 562.8ºC at 760 mmHg |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.27900 |
| Flash Point | 294.2ºC |
| Exact Mass | 248.09500 |
| PSA | 48.91000 |
| LogP | 3.88330 |
| Index of Refraction | 1.842 |
| InChIKey | JYUPGHDIRBJNOV-UHFFFAOYSA-N |
| SMILES | Cc1c2ccncc2cc2c1[nH]c1ccc(O)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Methyl-9-hydroxy-6H-pyrido(4,3-b)carbazole |
| 9-Hydroxy-11-demethylellipticine |
| 5-Methyl-6H-pyrido(4,3-b)carbazol-9-ol |
| 5-methyl-6H-pyrido[3,4-h]carbazol-9-ol |
| 6H-Pyrido(4,3-b)carbazol-9-ol,5-methyl |