Phenol,4-bromo-2-[[(4-methyl-2-benzothiazolyl)imino]methyl]- structure
|
Common Name | Phenol,4-bromo-2-[[(4-methyl-2-benzothiazolyl)imino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 77203-63-5 | Molecular Weight | 347.23000 | |
| Density | 1.74g/cm3 | Boiling Point | 444.4ºC at 760 mmHg | |
| Molecular Formula | C15H11BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | (6E)-4-bromo-6-[[(4-methyl-1,3-benzothiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760 mmHg |
| Molecular Formula | C15H11BrN2OS |
| Molecular Weight | 347.23000 |
| Flash Point | 222.6ºC |
| Exact Mass | 345.97800 |
| PSA | 73.72000 |
| LogP | 4.82340 |
| Index of Refraction | 1.852 |
| InChIKey | KCEYINNNSUTIRC-UHFFFAOYSA-N |
| SMILES | Cc1cccc2sc(N=Cc3cc(Br)ccc3O)nc12 |
|
~58%
Phenol,4-bromo-... CAS#:77203-63-5 |
| Literature: Dash, B.; Patra, M.; Praharaj, S. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 10 p. 894 - 897 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Aminobenzothiazole |