6-[[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 77203-45-3 | Molecular Weight | 310.37000 | |
| Density | 1.372g/cm3 | Boiling Point | 516.5ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
| Name | (6E)-6-[[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 516.5ºC at 760 mmHg |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.37000 |
| Flash Point | 266.2ºC |
| Exact Mass | 310.07800 |
| PSA | 82.95000 |
| LogP | 4.27490 |
| Index of Refraction | 1.729 |
| InChIKey | UOVAJJADOACBJK-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2csc(N=Cc3ccccc3O)n2)cc1 |
|
~71%
6-[[[4-(4-metho... CAS#:77203-45-3 |
| Literature: Dash, B.; Patra, M.; Praharaj, S. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 10 p. 894 - 897 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |