6-[[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 77203-44-2 | Molecular Weight | 314.78900 | |
| Density | 1.47g/cm3 | Boiling Point | 510.1ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.3ºC | |
| Name | (6E)-6-[[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 510.1ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.78900 |
| Flash Point | 262.3ºC |
| Exact Mass | 314.02800 |
| PSA | 73.72000 |
| LogP | 4.91970 |
| Index of Refraction | 1.763 |
| InChIKey | ANMQVIDUWYZORB-GIJQJNRQSA-N |
| SMILES | Oc1ccccc1C=Nc1nc(-c2ccc(Cl)cc2)cs1 |
|
~80%
6-[[[4-(4-chlor... CAS#:77203-44-2 |
| Literature: Kottawar; Goswami; Thorat; Bhusare E-Journal of Chemistry, 2011 , vol. 8, # 4 p. 1859 - 1863 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |