2-Propen-1-one,3-(3-bromophenyl)-1-(4-chlorophenyl)-
Modify Date: 2025-09-23 21:06:16
2-Propen-1-one,3-(3-bromophenyl)-1-(4-chlorophenyl)- structure
|
Common Name | 2-Propen-1-one,3-(3-bromophenyl)-1-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 77153-27-6 | Molecular Weight | 321.59600 | |
| Density | 1.475g/cm3 | Boiling Point | 435.4ºC at 760mmHg | |
| Molecular Formula | C15H10BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | 3-(3-bromophenyl)-1-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 435.4ºC at 760mmHg |
| Molecular Formula | C15H10BrClO |
| Molecular Weight | 321.59600 |
| Flash Point | 217.1ºC |
| Exact Mass | 319.96000 |
| PSA | 17.07000 |
| LogP | 4.99860 |
| Index of Refraction | 1.652 |
| InChIKey | CLCKUHZBRBOVTR-RUDMXATFSA-N |
| SMILES | O=C(C=Cc1cccc(Br)c1)c1ccc(Cl)cc1 |
|
~83%
2-Propen-1-one,... CAS#:77153-27-6 |
| Literature: Applequist, Douglas E.; Gdanski, Rick D. Journal of Organic Chemistry, 1981 , vol. 46, # 12 p. 2502 - 2510 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Bromo-4'-chlorochalcone |
| 3-bromo-4-chlorobenzophenone |