1H-Indole-1-carboxylic acid, 2-borono-5-[[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]methyl]-, 1-(1,1-dimethylethyl) ester structure
|
Common Name | 1H-Indole-1-carboxylic acid, 2-borono-5-[[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]methyl]-, 1-(1,1-dimethylethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 771477-41-9 | Molecular Weight | 459.344 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 604.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C23H34BN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.3±34.3 °C | |
| Name | 1H-Indole-1-carboxylic acid, 2-borono-5-[[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]methyl]-, 1-(1,1-dimethylethyl) ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 604.4±65.0 °C at 760 mmHg |
| Molecular Formula | C23H34BN3O6 |
| Molecular Weight | 459.344 |
| Flash Point | 319.3±34.3 °C |
| Exact Mass | 459.254059 |
| PSA | 104.47000 |
| LogP | 3.50 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | LCYMQKQCXOHACB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc3c(c2)cc(B(O)O)n3C(=O)OC(C)(C)C)CC1 |
|
~%
1H-Indole-1-car... CAS#:771477-41-9 |
| Literature: MERCK and CO. INC. Patent: WO2004/87651 A2, 2004 ; Location in patent: Page 10 ; WO 2004/087651 A2 |
| (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-[(4-{[(2-methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)methyl]-1H-indol-2-yl)boronic acid |
| 1H-Indole-1-carbonyl chloride (9CI) |
| indole-2-boronic acid-5-(4-tert-butoxycarbonyl-piperazin-1-ylmethyl)-indole-1-carboxylic acid tert-butyl ester |
| 1H-Indole-1-carboxylic acid, 2-borono-5-[[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]methyl]-, 1,1-dimethylethyl ester |
| 1H-Indole-1-carbonylchloride |
| [1-(tert-butoxycarbonyl)-5-{[4-(tert-butoxycarbonyl)piperazin-1-yl]methyl}-1H-indol-2-yl]boronic acid |