1-N-Boc-4-(4-Bromophenyl)piperidine structure
|
Common Name | 1-N-Boc-4-(4-Bromophenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 769944-78-7 | Molecular Weight | 340.255 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 398.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8±27.9 °C | |
| Name | 1-N-Boc-4-(4-Bromophenyl)Piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.5±42.0 °C at 760 mmHg |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.255 |
| Flash Point | 194.8±27.9 °C |
| Exact Mass | 339.083374 |
| PSA | 29.54000 |
| LogP | 4.37 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | UEOHLUHRQWYQRT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(Br)cc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~98%
1-N-Boc-4-(4-Br... CAS#:769944-78-7 |
| Literature: SCHERING CORPORATION; MANSOOR, Umar, Faruk; REDDY, Panduranga, Adulla; SIDDIQUI, M., Arshad Patent: WO2010/17060 A1, 2010 ; Location in patent: Page/Page column 31 ; WO 2010/017060 A1 |
|
~%
1-N-Boc-4-(4-Br... CAS#:769944-78-7 |
| Literature: WO2009/7390 A2, ; Page/Page column 96 ; WO 2009/007390 A2 |
|
~%
1-N-Boc-4-(4-Br... CAS#:769944-78-7 |
| Literature: WO2007/126957 A2, ; Page/Page column 101 ; WO 2007/126957 A2 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 4-(4-bromophenyl)-, 1,1-dimethylethyl ester |
| tert-Butyl 4-(4-bromophenyl)piperidine-1-carboxylate |
| 2-Methyl-2-propanyl 4-(4-bromophenyl)-1-piperidinecarboxylate |
| 1-Boc-4-(4-Bromo-phenyl)-piperidine |