p-nitrophenyl beta-d-n,n',n''-triacetylchitotriose structure
|
Common Name | p-nitrophenyl beta-d-n,n',n''-triacetylchitotriose | ||
|---|---|---|---|---|
| CAS Number | 7699-38-9 | Molecular Weight | 748.68600 | |
| Density | 1.58g/cm3 | Boiling Point | 1184.8ºC at 760 mmHg | |
| Molecular Formula | C30H44N4O18 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 670.3ºC | |
| Name | N-[2-[5-acetamido-6-[5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-4-hydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 1184.8ºC at 760 mmHg |
| Molecular Formula | C30H44N4O18 |
| Molecular Weight | 748.68600 |
| Flash Point | 670.3ºC |
| Exact Mass | 748.26500 |
| PSA | 330.11000 |
| Index of Refraction | 1.637 |
| InChIKey | UWYYAJFSFHIFNY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(OC2C(CO)OC(OC3C(CO)OC(Oc4ccc([N+](=O)[O-])cc4)C(NC(C)=O)C3O)C(NC(C)=O)C2O)OC(CO)C(O)C1O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Osawa, T. and Nakazawa, Y.
Biochim. Biophys. Acta 130 , 56, (1966)
|
| MFCD00057914 |