N,N-bis(2-chloroprop-2-enyl)benzohydrazide structure
|
Common Name | N,N-bis(2-chloroprop-2-enyl)benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 7696-77-7 | Molecular Weight | 285.16900 | |
| Density | 1.228g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2R,3S,4R,5R)-5-(6-amino-2-propan-2-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.16900 |
| Exact Mass | 284.04800 |
| PSA | 32.34000 |
| LogP | 3.52930 |
| Index of Refraction | 1.564 |
| InChIKey | ISMSORBXYWFXOG-UHFFFAOYSA-N |
| SMILES | C=C(Cl)CN(CC(=C)Cl)NC(=O)c1ccccc1 |
|
~%
N,N-bis(2-chlor... CAS#:7696-77-7 |
| Literature: Gillis; Kadunce The Journal of organic chemistry, 1967 , vol. 32, # 1 p. 91 - 94 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Benzoyl-2,2-bis-(2-chlor-allyl)-hydrazin |