1-(p-Methoxybenzyl)-4,6-diphenylpyridine-2-thione structure
|
Common Name | 1-(p-Methoxybenzyl)-4,6-diphenylpyridine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 76950-87-3 | Molecular Weight | 383.50500 | |
| Density | 1.24g/cm3 | Boiling Point | 566.9ºC at 760 mmHg | |
| Molecular Formula | C25H21NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.7ºC | |
| Name | 1-[(4-methoxyphenyl)methyl]-4,6-diphenylpyridine-2-thione |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 566.9ºC at 760 mmHg |
| Molecular Formula | C25H21NOS |
| Molecular Weight | 383.50500 |
| Flash Point | 296.7ºC |
| Exact Mass | 383.13400 |
| PSA | 46.25000 |
| LogP | 6.60850 |
| Index of Refraction | 1.695 |
| InChIKey | ORAHQMOKJUOINF-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cn2c(-c3ccccc3)cc(-c3ccccc3)cc2=S)cc1 |
| HS Code | 2933399090 |
|---|
|
~74%
1-(p-Methoxyben... CAS#:76950-87-3 |
| Literature: Lorenzo, A.; Molina, P.; Vilaplana, M. J. Synthesis, 1980 , # 10 p. 853 - 854 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |