4-dimethylamino-1,3-diphenyl-butan-2-one structure
|
Common Name | 4-dimethylamino-1,3-diphenyl-butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 76932-64-4 | Molecular Weight | 267.36500 | |
| Density | 1.052g/cm3 | Boiling Point | 382.3ºC at 760 mmHg | |
| Molecular Formula | C18H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.1ºC | |
| Name | 4-(dimethylamino)-1,3-diphenylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 382.3ºC at 760 mmHg |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.36500 |
| Flash Point | 113.1ºC |
| Exact Mass | 267.16200 |
| PSA | 20.31000 |
| LogP | 3.14360 |
| Index of Refraction | 1.563 |
| InChIKey | NIISBOCIVFUFDB-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C(=O)Cc1ccccc1)c1ccccc1 |
|
~%
4-dimethylamino... CAS#:76932-64-4 |
| Literature: Wilson; Kyi Journal of the Chemical Society, 1952 , p. 1321,1325 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HMS3078N24 |
| 4-Dimethylamino-1,3-diphenyl-2-butanon |
| 4-dimethylamino-1,3-diphenyl-butan-2-one |