2-Amino-4,4-diphenylbutanoic acid
Modify Date: 2025-09-06 14:39:39
2-Amino-4,4-diphenylbutanoic acid structure
|
Common Name | 2-Amino-4,4-diphenylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 76932-45-1 | Molecular Weight | 255.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-4,4-diphenylbutanoic acid |
|---|
| Molecular Formula | C16H17NO2 |
|---|---|
| Molecular Weight | 255.31200 |
| Exact Mass | 255.12600 |
| PSA | 63.32000 |
| LogP | 3.32080 |
| InChIKey | MVJJVBXNVIAWLB-UHFFFAOYSA-N |
| SMILES | NC(CC(c1ccccc1)c1ccccc1)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |