N-(2-phenylphenyl)-4,5-dihydro-1H-imidazol-2-amine structure
|
Common Name | N-(2-phenylphenyl)-4,5-dihydro-1H-imidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 76841-24-2 | Molecular Weight | 237.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-phenylphenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|
| Molecular Formula | C15H15N3 |
|---|---|
| Molecular Weight | 237.30000 |
| Exact Mass | 237.12700 |
| PSA | 36.42000 |
| LogP | 2.56210 |
| InChIKey | HWYFLVMVVXZJBP-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccccc2NC2=NCCN2)cc1 |
|
~62%
N-(2-phenylphen... CAS#:76841-24-2 |
| Literature: Taniguchi; Katsura; Ueda; Matsuo Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 240 - 244 |
|
~%
N-(2-phenylphen... CAS#:76841-24-2 |
| Literature: Taniguchi; Katsura; Ueda; Matsuo Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 240 - 244 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |