N-[(3-phenylphenyl)carbamothioyl]benzamide structure
|
Common Name | N-[(3-phenylphenyl)carbamothioyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 76838-57-8 | Molecular Weight | 332.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(3-phenylphenyl)carbamothioyl]benzamide |
|---|
| Molecular Formula | C20H16N2OS |
|---|---|
| Molecular Weight | 332.41900 |
| Exact Mass | 332.09800 |
| PSA | 83.75000 |
| LogP | 5.27570 |
| InChIKey | GERGQEWDJQXHNW-UHFFFAOYSA-N |
| SMILES | O=C(NC(=S)Nc1cccc(-c2ccccc2)c1)c1ccccc1 |
|
~70%
N-[(3-phenylphe... CAS#:76838-57-8 |
| Literature: Taniguchi; Katsura; Ueda; Matsuo Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 240 - 244 |
|
~%
N-[(3-phenylphe... CAS#:76838-57-8 |
| Literature: Taniguchi; Katsura; Ueda; Matsuo Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 240 - 244 |