galacturonic acid, compound with (9S)-6'-methoxycinchonan-9-ol structure
|
Common Name | galacturonic acid, compound with (9S)-6'-methoxycinchonan-9-ol | ||
|---|---|---|---|---|
| CAS Number | 7681-28-9 | Molecular Weight | 518.55600 | |
| Density | N/A | Boiling Point | 495.9ºC at 760 mmHg | |
| Molecular Formula | C26H34N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | (9S)-6'-Methoxycinchonan-9-ol-D-galacturonic acid (1:1) |
|---|
| Boiling Point | 495.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H34N2O9 |
| Molecular Weight | 518.55600 |
| Flash Point | 253.7ºC |
| Exact Mass | 518.22600 |
| PSA | 180.88000 |
| InChIKey | KUTGSSTVCUKONV-JWVVETNKSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.O=CC(O)C(O)C(O)C(O)C(=O)O |