2',4',7-trihydroxyisoflavone structure
|
Common Name | 2',4',7-trihydroxyisoflavone | ||
|---|---|---|---|---|
| CAS Number | 7678-85-5 | Molecular Weight | 270.24 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 575.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2±23.6 °C | |
Use of 2',4',7-trihydroxyisoflavone2′-Hydroxydaidzein is a metabolite. 2′-Hydroxydaidzein inhibits the release of chemical mediator from inflammatory cells. 2′-Hydroxydaidzein significantly inhibits lysozyme and β-glucuronidase release from rat neutrophils, which is stimulated with fMLP/CB, respectively[1]. |
| Name | 2'-hydroxydaidzein |
|---|---|
| Synonym | More Synonyms |
| Description | 2′-Hydroxydaidzein is a metabolite. 2′-Hydroxydaidzein inhibits the release of chemical mediator from inflammatory cells. 2′-Hydroxydaidzein significantly inhibits lysozyme and β-glucuronidase release from rat neutrophils, which is stimulated with fMLP/CB, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.7±50.0 °C at 760 mmHg |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| Flash Point | 225.2±23.6 °C |
| Exact Mass | 270.052826 |
| PSA | 90.90000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | ZCTNPCRBEWXCGP-UHFFFAOYSA-N |
| SMILES | O=c1c(-c2ccc(O)cc2O)coc2cc(O)ccc12 |
|
~61%
2',4',7-trihydr... CAS#:7678-85-5 |
| Literature: Woodward, Michael D. Phytochemistry (Elsevier), 1980 , vol. 19, p. 921 - 928 |
|
~%
2',4',7-trihydr... CAS#:7678-85-5 |
| Literature: Visser, Frans R.; Lane, Geoffrey A. Australian Journal of Chemistry, 1987 , vol. 40, # 10 p. 1705 - 1711 |
|
~%
2',4',7-trihydr... CAS#:7678-85-5 |
| Literature: Wyeth Patent: US2003/87955 A1, 2003 ; US 20030087955 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2',4',7-trihydroxyisoflavone |
| 4H-1-Benzopyran-4-one, 3-(2,4-dihydroxyphenyl)-7-hydroxy- |
| 3-(2,4-dihydroxyphenyl)-7-hydroxychromen-4-one |
| 3-(2,4-Dihydroxyphenyl)-7-hydroxy-4H-chromen-4-one |
| 7,2',4'-trihydroxyisoflavone |
| 2'-hydroxyformononetin |