N1-(3-Nitrophenyl)-1,3-benzenediamine
Modify Date: 2026-07-04 17:47:58
N1-(3-Nitrophenyl)-1,3-benzenediamine structure
|
Common Name | N1-(3-Nitrophenyl)-1,3-benzenediamine | ||
|---|---|---|---|---|
| CAS Number | 76754-72-8 | Molecular Weight | 229.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(3-Nitrophenyl)-1,3-benzenediamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11N3O2 |
|---|---|
| Molecular Weight | 229.23 |
| InChIKey | PUEGGOAMJZHFSN-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Nc2cccc([N+](=O)[O-])c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N1-(3-Nitrophenyl)-1,3-benzenediamine? |
| A: Molecular weight of N1-(3-Nitrophenyl)-1,3-benzenediamine is 229.23. |
| Q: What is the Chinese name of 76754-72-8? |
| A: Chinese name of 76754-72-8 is 76754-72-8. |
| Q: What is the CAS number of N1-(3-Nitrophenyl)-1,3-benzenediamine? |
| A: CAS number of N1-(3-Nitrophenyl)-1,3-benzenediamine is 76754-72-8. |
| Q: What is the SMILES notation of N1-(3-Nitrophenyl)-1,3-benzenediamine? |
| A: SMILES notation of N1-(3-Nitrophenyl)-1,3-benzenediamine is Nc1cccc(Nc2cccc([N+](=O)[O-])c2)c1. |
| Q: What is the molecular formula of N1-(3-Nitrophenyl)-1,3-benzenediamine? |
| A: Molecular formula of N1-(3-Nitrophenyl)-1,3-benzenediamine is C12H11N3O2. |
| Q: What is the English name of N1-(3-Nitrophenyl)-1,3-benzenediamine? |
| A: The English name of N1-(3-Nitrophenyl)-1,3-benzenediamine is N1-(3-Nitrophenyl)-1,3-benzenediamine. |
| Q: What is the InChIKey of N1-(3-Nitrophenyl)-1,3-benzenediamine? |
| A: InChIKey of N1-(3-Nitrophenyl)-1,3-benzenediamine is PUEGGOAMJZHFSN-UHFFFAOYSA-N. |