Cannflavin B
Modify Date: 2024-01-05 10:42:02
Cannflavin B structure
|
Common Name | Cannflavin B | ||
|---|---|---|---|---|
| CAS Number | 76735-58-5 | Molecular Weight | 368.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cannflavin BCannflavin B is a prenylated flavone, which can be isolated from Cannabis sativa L. Cannflavin B has anti-inflammatory activity[1]. |
| Name | Cannflavin B |
|---|
| Description | Cannflavin B is a prenylated flavone, which can be isolated from Cannabis sativa L. Cannflavin B has anti-inflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H20O6 |
|---|---|
| Molecular Weight | 368.38 |
| InChIKey | IXCUTZUASDSIJO-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(CC=C(C)C)c(O)cc3o2)ccc1O |