bis(trimethylsilyl) but-2-ynedioate
Modify Date: 2025-08-25 12:46:38
bis(trimethylsilyl) but-2-ynedioate structure
|
Common Name | bis(trimethylsilyl) but-2-ynedioate | ||
|---|---|---|---|---|
| CAS Number | 76734-92-4 | Molecular Weight | 258.41900 | |
| Density | 0.999 g/mL at 25ºC(lit.) | Boiling Point | 94ºC0.005 mm Hg(lit.) | |
| Molecular Formula | C10H18O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 67ºC | |
| Name | bis(trimethylsilyl) but-2-ynedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 94ºC0.005 mm Hg(lit.) |
| Molecular Formula | C10H18O4Si2 |
| Molecular Weight | 258.41900 |
| Flash Point | 67ºC |
| Exact Mass | 258.07400 |
| PSA | 52.60000 |
| LogP | 1.74600 |
| Index of Refraction | n20/D 1.439(lit.) |
| InChIKey | RYHMNBZWRLSKHY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=O)C#CC(=O)O[Si](C)(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | UN 1993 3/PG 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
|
~91%
bis(trimethylsi... CAS#:76734-92-4 |
| Literature: Hergott, Hans Herbert; Simchen, Gerhard Synthesis, 1980 , # 8 p. 626 - 627 |
|
~90%
bis(trimethylsi... CAS#:76734-92-4 |
| Literature: Verboom, W.; Visser, G. W.; Reinhoudt, D. N. Synthesis, 1981 , # 10 p. 807 - 809 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ester |
| Bis(trimethylsilyl) 2-butynedioate |
| 2-Butynedioic acid,ditrimethylsilyl |
| Me3SiO2CCCCO2SiMe3 |
| Bis-trimethylsilylacetylenedicarboxylate |