ethyl 2-oxo-7-phenyl-1,4-diazabicyclo[3.3.0]oct-4-ene-3-carboxylate structure
|
Common Name | ethyl 2-oxo-7-phenyl-1,4-diazabicyclo[3.3.0]oct-4-ene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76696-82-7 | Molecular Weight | 272.29900 | |
| Density | 1.33g/cm3 | Boiling Point | 399.3ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3ºC | |
| Name | ethyl 3-oxo-6-phenyl-2,5,6,7-tetrahydropyrrolo[1,2-a]imidazole-2-carboxylate |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 399.3ºC at 760 mmHg |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.29900 |
| Flash Point | 195.3ºC |
| Exact Mass | 272.11600 |
| PSA | 58.97000 |
| LogP | 0.71980 |
| Index of Refraction | 1.643 |
| InChIKey | VPLWKSMESAPKHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1N=C2CC(c3ccccc3)CN2C1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |