1-Butyl-2,3-Dimethylimidazolium Trifluoromethanesulfonate structure
|
Common Name | 1-Butyl-2,3-Dimethylimidazolium Trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 765910-73-4 | Molecular Weight | 302.314 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17F3N2O3S | Melting Point | 44 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Butyl-2,3-Dimethylimidazolium Trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 44 °C |
|---|---|
| Molecular Formula | C10H17F3N2O3S |
| Molecular Weight | 302.314 |
| Exact Mass | 302.091187 |
| PSA | 74.39000 |
| LogP | 2.55330 |
| Index of Refraction | 1.446-1.448 |
| InChIKey | KSOGGGZFEJTGPZ-UHFFFAOYSA-M |
| SMILES | CCCCn1cc[n+](C)c1C.O=S(=O)([O-])C(F)(F)F |
| Storage condition | 0-10°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38-21/22 |
| Safety Phrases | 37/39-26 |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03427624 |
| 1-Butyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate |
| 1-butyl-2,3-dimethyl-imidazolium trifluoromethane sulfonate |
| 1-butyl-2,3-dimethylimidazol-3-ium,trifluoromethanesulfonate |