4-(3-methoxyphenyl)but-1-ynoxy-tri(propan-2-yl)silane
Modify Date: 2025-08-23 13:25:26
4-(3-methoxyphenyl)but-1-ynoxy-tri(propan-2-yl)silane structure
|
Common Name | 4-(3-methoxyphenyl)but-1-ynoxy-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 765906-58-9 | Molecular Weight | 332.55200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H32O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-methoxyphenyl)but-1-ynoxy-tri(propan-2-yl)silane |
|---|
| Molecular Formula | C20H32O2Si |
|---|---|
| Molecular Weight | 332.55200 |
| Exact Mass | 332.21700 |
| PSA | 18.46000 |
| LogP | 5.78080 |
| InChIKey | URBSZWIBAYKQDE-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCC#CO[Si](C(C)C)(C(C)C)C(C)C)c1 |
|
~94%
4-(3-methoxyphe... CAS#:765906-58-9 |
| Literature: Zhang, Liming; Sun, Jianwei; Kozmin, Sergey A. Tetrahedron, 2006 , vol. 62, # 49 p. 11371 - 11380 |
|
~%
4-(3-methoxyphe... CAS#:765906-58-9 |
| Literature: Zhang, Liming; Kozmin, Sergey A. Journal of the American Chemical Society, 2004 , vol. 126, # 33 p. 10204 - 10205 |
|
~%
4-(3-methoxyphe... CAS#:765906-58-9 |
| Literature: Zhang, Liming; Kozmin, Sergey A. Journal of the American Chemical Society, 2004 , vol. 126, # 33 p. 10204 - 10205 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |