2,4,6-Pteridinetriamine,N6-methyl-N6-(9-phenanthrenylmethyl)-
Modify Date: 2025-09-15 18:18:09
2,4,6-Pteridinetriamine,N6-methyl-N6-(9-phenanthrenylmethyl)- structure
|
Common Name | 2,4,6-Pteridinetriamine,N6-methyl-N6-(9-phenanthrenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 76532-25-7 | Molecular Weight | 381.43300 | |
| Density | 1.423g/cm3 | Boiling Point | 741.1ºC at 760 mmHg | |
| Molecular Formula | C22H19N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 402ºC | |
| Name | 6-N-methyl-6-N-(phenanthren-9-ylmethyl)pteridine-2,4,6-triamine |
|---|
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 741.1ºC at 760 mmHg |
| Molecular Formula | C22H19N7 |
| Molecular Weight | 381.43300 |
| Flash Point | 402ºC |
| Exact Mass | 381.17000 |
| PSA | 106.84000 |
| LogP | 4.68940 |
| Index of Refraction | 1.847 |
| InChIKey | ILCAOCPBLOKKLI-UHFFFAOYSA-N |
| SMILES | CN(Cc1cc2ccccc2c2ccccc12)c1cnc2nc(N)nc(N)c2n1 |
|
~%
2,4,6-Pteridine... CAS#:76532-25-7 |
| Literature: Elslager, Edward F.; Johnson, Judith L.; Werbel, Leslie M. Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 140 - 145 |
|
~12%
2,4,6-Pteridine... CAS#:76532-25-7 |
| Literature: Elslager, Edward F.; Johnson, Judith L.; Werbel, Leslie M. Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 140 - 145 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |