4’-C-Methyl-5-methylcytidine structure
|
Common Name | 4’-C-Methyl-5-methylcytidine | ||
|---|---|---|---|---|
| CAS Number | 764644-12-4 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4’-C-Methyl-5-methylcytidine4’-C-Methyl-5-methylcytidine is a cytidine nucleoside analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
| Name | 4'-C-Methyl-5-methylcytidine |
|---|
| Description | 4’-C-Methyl-5-methylcytidine is a cytidine nucleoside analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
|---|---|
| Related Catalog | |
| References |
| InChIKey | QPQNHDFVLQCOLG-UHFFFAOYSA-N |
|---|---|
| SMILES | Cc1cn(C2OC(C)(CO)C(O)C2O)c(=O)nc1N |