4-ethylhex-2-en-3-yloxy(trimethyl)silane
Modify Date: 2025-09-10 12:53:20
4-ethylhex-2-en-3-yloxy(trimethyl)silane structure
|
Common Name | 4-ethylhex-2-en-3-yloxy(trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 76436-97-0 | Molecular Weight | 200.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethylhex-2-en-3-yloxy(trimethyl)silane |
|---|
| Molecular Formula | C11H24OSi |
|---|---|
| Molecular Weight | 200.39300 |
| Exact Mass | 200.16000 |
| PSA | 9.23000 |
| LogP | 4.17790 |
| InChIKey | MQWGDVFUFAXJAL-UHFFFAOYSA-N |
| SMILES | CC=C(O[Si](C)(C)C)C(CC)CC |
|
~%
4-ethylhex-2-en... CAS#:76436-97-0 |
| Literature: Kuwajima, Isao; Kato, Masahiro; Mori, Akio Tetrahedron Letters, 1980 , vol. 21, p. 2745 - 2748 |
|
~%
4-ethylhex-2-en... CAS#:76436-97-0 |
| Literature: Kato; Mori; Oshino; Enda; Kobayashi; Kuwajima Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1773 - 1778 |
|
~%
4-ethylhex-2-en... CAS#:76436-97-0 |
| Literature: Kato; Mori; Oshino; Enda; Kobayashi; Kuwajima Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1773 - 1778 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |